About 5-(3,4-dimethylphenyl)sulfinylpentanenitrile
5-(3,4-dimethylphenyl)sulfinylpentanenitrile (PubChem CID 63790520) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)sulfinylpentanenitrile.
Molecular Properties
| Compound Name | 5-(3,4-dimethylphenyl)sulfinylpentanenitrile |
| PubChem CID | 63790520 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-(3,4-dimethylphenyl)sulfinylpentanenitrile |
| SMILES | Cc1ccc(S(=O)CCCCC#N)cc1C |
| InChI | InChI=1S/C13H17NOS/c1-11-6-7-13(10-12(11)2)16(15)9-5-3-4-8-14/h6-7,10H,3-5,9H2,1-2H3 |
| InChIKey | SDCVSGADFPNQEU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4-dimethylphenyl)sulfinylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)sulfinylpentanenitrile?
The IUPAC name of 5-(3,4-dimethylphenyl)sulfinylpentanenitrile (CID 63790520) is 5-(3,4-dimethylphenyl)sulfinylpentanenitrile.
What is the SMILES notation for 5-(3,4-dimethylphenyl)sulfinylpentanenitrile?
The canonical SMILES for 5-(3,4-dimethylphenyl)sulfinylpentanenitrile is Cc1ccc(S(=O)CCCCC#N)cc1C.
What is the InChIKey of 5-(3,4-dimethylphenyl)sulfinylpentanenitrile?
The InChIKey is SDCVSGADFPNQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NOS/c1-11-6-7-13(10-12(11)2)16(15)9-5-3-4-8-14/h6-7,10H,3-5,9H2,1-2H3.
What are the key properties of 5-(3,4-dimethylphenyl)sulfinylpentanenitrile?
5-(3,4-dimethylphenyl)sulfinylpentanenitrile has a molecular weight of 235.35 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)sulfinylpentanenitrile is sourced from PubChem (CID 63790520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).