About propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate
propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate (PubChem CID 6379140) has the molecular formula C8H12F3N3O2S
and a molecular weight of 271.26 g/mol. Its IUPAC name is propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate |
| PubChem CID | 6379140 |
| Molecular Formula | C8H12F3N3O2S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate |
| SMILES | CC(C)OC(=O)C/C(=N/NC(N)=S)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O2S/c1-4(2)16-6(15)3-5(8(9,10)11)13-14-7(12)17/h4H,3H2,1-2H3,(H3,12,14,17)/b13-5- |
| InChIKey | QTERFSBFOBPKNI-ACAGNQJTSA-N |
| XLogP | 1.08 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
The IUPAC name of propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate (CID 6379140) is propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate.
What is the SMILES notation for propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
The canonical SMILES for propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate is CC(C)OC(=O)C/C(=N/NC(N)=S)C(F)(F)F.
What is the InChIKey of propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
The InChIKey is QTERFSBFOBPKNI-ACAGNQJTSA-N. The full InChI is InChI=1S/C8H12F3N3O2S/c1-4(2)16-6(15)3-5(8(9,10)11)13-14-7(12)17/h4H,3H2,1-2H3,(H3,12,14,17)/b13-5-.
What are the key properties of propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate?
propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate has a molecular weight of 271.26 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (3Z)-3-(carbamothioylhydrazinylidene)-4,4,4-trifluorobutanoate is sourced from PubChem (CID 6379140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).