C10H10N2O5S2 — CID 63792679
2-methyl-3-(5-nitrothiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63792679) has the molecular formula C10H10N2O5S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-methyl-3-(5-nitrothiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-methyl-3-(5-nitrothiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63792679 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2-methyl-3-(5-nitrothiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1SCC(C(=O)O)N1C(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H10N2O5S2/c1-5-11(6(4-18-5)10(14)15)9(13)7-2-3-8(19-7)12(16)17/h2-3,5-6H,4H2,1H3,(H,14,15) |
| InChIKey | GARYCJWYEPTUIQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|