C13H21N3O2 — CID 63794382
2,6-dimethyl-3-[2-(oxolan-3-ylmethylamino)ethyl]pyrimidin-4-one (PubChem CID 63794382) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,6-dimethyl-3-[2-(oxolan-3-ylmethylamino)ethyl]pyrimidin-4-one.
| Compound Name | 2,6-dimethyl-3-[2-(oxolan-3-ylmethylamino)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 63794382 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2,6-dimethyl-3-[2-(oxolan-3-ylmethylamino)ethyl]pyrimidin-4-one |
| SMILES | Cc1cc(=O)n(CCNCC2CCOC2)c(C)n1 |
| InChI | InChI=1S/C13H21N3O2/c1-10-7-13(17)16(11(2)15-10)5-4-14-8-12-3-6-18-9-12/h7,12,14H,3-6,8-9H2,1-2H3 |
| InChIKey | ILYVRIUKYGWMJM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|