C14H19F2N — CID 63794443
1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]ethanamine (PubChem CID 63794443) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]ethanamine.
| Compound Name | 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63794443 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]ethanamine |
| SMILES | CC(NCc1cc(F)ccc1F)C1CCCC1 |
| InChI | InChI=1S/C14H19F2N/c1-10(11-4-2-3-5-11)17-9-12-8-13(15)6-7-14(12)16/h6-8,10-11,17H,2-5,9H2,1H3 |
| InChIKey | HUAAZHOZYMZYQM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |