About 3,5-dimethyl-1,3,5-oxadiazinane
3,5-dimethyl-1,3,5-oxadiazinane (PubChem CID 637964) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,5-oxadiazinane.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3,5-oxadiazinane |
| PubChem CID | 637964 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 3,5-dimethyl-1,3,5-oxadiazinane |
| SMILES | CN1COCN(C)C1 |
| InChI | InChI=1S/C5H12N2O/c1-6-3-7(2)5-8-4-6/h3-5H2,1-2H3 |
| InChIKey | POJNAHKFWBQMED-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-1,3,5-oxadiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3,5-oxadiazinane?
The IUPAC name of 3,5-dimethyl-1,3,5-oxadiazinane (CID 637964) is 3,5-dimethyl-1,3,5-oxadiazinane.
What is the SMILES notation for 3,5-dimethyl-1,3,5-oxadiazinane?
The canonical SMILES for 3,5-dimethyl-1,3,5-oxadiazinane is CN1COCN(C)C1.
What is the InChIKey of 3,5-dimethyl-1,3,5-oxadiazinane?
The InChIKey is POJNAHKFWBQMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-6-3-7(2)5-8-4-6/h3-5H2,1-2H3.
What are the key properties of 3,5-dimethyl-1,3,5-oxadiazinane?
3,5-dimethyl-1,3,5-oxadiazinane has a molecular weight of 116.16 g/mol, XLogP of -0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3,5-oxadiazinane is sourced from PubChem (CID 637964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).