C15H16N2O2S2 — CID 63796434
3-(4-hydroxybut-1-ynyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 63796434) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63796434 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1nc(CN(C)C(=O)c2sccc2C#CCCO)cs1 |
| InChI | InChI=1S/C15H16N2O2S2/c1-11-16-13(10-21-11)9-17(2)15(19)14-12(6-8-20-14)5-3-4-7-18/h6,8,10,18H,4,7,9H2,1-2H3 |
| InChIKey | JBUPCCSRYPKVIA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|