C15H15NO2S2 — CID 63796920
3-(4-hydroxybut-1-ynyl)-N-(1-thiophen-2-ylethyl)thiophene-2-carboxamide (PubChem CID 63796920) has the molecular formula C15H15NO2S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(1-thiophen-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(1-thiophen-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63796920 |
| Molecular Formula | C15H15NO2S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(1-thiophen-2-ylethyl)thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1sccc1C#CCCO)c1cccs1 |
| InChI | InChI=1S/C15H15NO2S2/c1-11(13-6-4-9-19-13)16-15(18)14-12(7-10-20-14)5-2-3-8-17/h4,6-7,9-11,17H,3,8H2,1H3,(H,16,18) |
| InChIKey | XCNFBCZICDSQNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|