About 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid
3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid (PubChem CID 63798858) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid.
Analyze 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid?
The IUPAC name of 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid (CID 63798858) is 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid.
What is the SMILES notation for 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid?
The canonical SMILES for 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid is Cn1cc(N)c(=O)n(CCC(=O)O)c1=O.
What is the InChIKey of 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid?
The InChIKey is VDQAISXXMJREEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c1-10-4-5(9)7(14)11(8(10)15)3-2-6(12)13/h4H,2-3,9H2,1H3,(H,12,13).
What are the key properties of 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid?
3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid has a molecular weight of 213.19 g/mol, XLogP of -1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-amino-3-methyl-2,6-dioxopyrimidin-1-yl)propanoic acid is sourced from PubChem (CID 63798858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).