C10H15N3O6 — CID 63798898
1-ethyl-3-[2-(2-hydroxyethoxy)ethyl]-5-nitropyrimidine-2,4-dione (PubChem CID 63798898) has the molecular formula C10H15N3O6 and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-hydroxyethoxy)ethyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-[2-(2-hydroxyethoxy)ethyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63798898 |
| Molecular Formula | C10H15N3O6 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-ethyl-3-[2-(2-hydroxyethoxy)ethyl]-5-nitropyrimidine-2,4-dione |
| SMILES | CCn1cc([N+](=O)[O-])c(=O)n(CCOCCO)c1=O |
| InChI | InChI=1S/C10H15N3O6/c1-2-11-7-8(13(17)18)9(15)12(10(11)16)3-5-19-6-4-14/h7,14H,2-6H2,1H3 |
| InChIKey | CKOAFDBQBBOUKB-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|