C13H14N2O4 — CID 63799114
3-[2-(furan-2-yl)-2-oxoethyl]-1-propylpyrimidine-2,4-dione (PubChem CID 63799114) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)-2-oxoethyl]-1-propylpyrimidine-2,4-dione.
| Compound Name | 3-[2-(furan-2-yl)-2-oxoethyl]-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63799114 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[2-(furan-2-yl)-2-oxoethyl]-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1ccc(=O)n(CC(=O)c2ccco2)c1=O |
| InChI | InChI=1S/C13H14N2O4/c1-2-6-14-7-5-12(17)15(13(14)18)9-10(16)11-4-3-8-19-11/h3-5,7-8H,2,6,9H2,1H3 |
| InChIKey | QMLDXPLLGBJBFR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |