C11H16F3N3O3 — CID 63799586
5-amino-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione (PubChem CID 63799586) has the molecular formula C11H16F3N3O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 5-amino-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63799586 |
| Molecular Formula | C11H16F3N3O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-amino-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
| SMILES | CCn1cc(N)c(=O)n(CCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H16F3N3O3/c1-2-16-6-8(15)9(18)17(10(16)19)4-3-5-20-7-11(12,13)14/h6H,2-5,7,15H2,1H3 |
| InChIKey | HLTGDXZWBKKUJI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|