C10H15N3O4 — CID 63800101
ethyl 2-(5-amino-3-ethyl-2,6-dioxopyrimidin-1-yl)acetate (PubChem CID 63800101) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is ethyl 2-(5-amino-3-ethyl-2,6-dioxopyrimidin-1-yl)acetate.
| Compound Name | ethyl 2-(5-amino-3-ethyl-2,6-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 63800101 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethyl 2-(5-amino-3-ethyl-2,6-dioxopyrimidin-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(N)cn(CC)c1=O |
| InChI | InChI=1S/C10H15N3O4/c1-3-12-5-7(11)9(15)13(10(12)16)6-8(14)17-4-2/h5H,3-4,6,11H2,1-2H3 |
| InChIKey | ZAPNEPYAZIFMPQ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |