C14H20N2O2S — CID 63800749
3-(3-aminoprop-1-ynyl)-N-ethyl-N-(1-methoxypropan-2-yl)thiophene-2-carboxamide (PubChem CID 63800749) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-ethyl-N-(1-methoxypropan-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-ethyl-N-(1-methoxypropan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63800749 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-ethyl-N-(1-methoxypropan-2-yl)thiophene-2-carboxamide |
| SMILES | CCN(C(=O)c1sccc1C#CCN)C(C)COC |
| InChI | InChI=1S/C14H20N2O2S/c1-4-16(11(2)10-18-3)14(17)13-12(6-5-8-15)7-9-19-13/h7,9,11H,4,8,10,15H2,1-3H3 |
| InChIKey | QRPQHQNEPMLIAH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|