About cyclohepta[d]imidazole
cyclohepta[d]imidazole (PubChem CID 638009) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is cyclohepta[d]imidazole.
Molecular Properties
| Compound Name | cyclohepta[d]imidazole |
| PubChem CID | 638009 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | cyclohepta[d]imidazole |
| SMILES | c1ccc2ncnc-2cc1 |
| InChI | InChI=1S/C8H6N2/c1-2-4-7-8(5-3-1)10-6-9-7/h1-6H |
| InChIKey | HPGSSIJHLUDJFV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohepta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[d]imidazole?
The IUPAC name of cyclohepta[d]imidazole (CID 638009) is cyclohepta[d]imidazole.
What is the SMILES notation for cyclohepta[d]imidazole?
The canonical SMILES for cyclohepta[d]imidazole is c1ccc2ncnc-2cc1.
What is the InChIKey of cyclohepta[d]imidazole?
The InChIKey is HPGSSIJHLUDJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-7-8(5-3-1)10-6-9-7/h1-6H.
What are the key properties of cyclohepta[d]imidazole?
cyclohepta[d]imidazole has a molecular weight of 130.15 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[d]imidazole is sourced from PubChem (CID 638009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).