C26H24N4O7 — CID 6380098
(4Z)-4-[[5-[[(E)-(3-carboxy-1-phenylpropylidene)amino]carbamoyl]furan-2-carbonyl]hydrazinylidene]-4-phenylbutanoic acid (PubChem CID 6380098) has the molecular formula C26H24N4O7 and a molecular weight of 504.50 g/mol. Its IUPAC name is (4Z)-4-[[5-[[(E)-(3-carboxy-1-phenylpropylidene)amino]carbamoyl]furan-2-carbonyl]hydrazinylidene]-4-phenylbutanoic acid.
| Compound Name | (4Z)-4-[[5-[[(E)-(3-carboxy-1-phenylpropylidene)amino]carbamoyl]furan-2-carbonyl]hydrazinylidene]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 6380098 |
| Molecular Formula | C26H24N4O7 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (4Z)-4-[[5-[[(E)-(3-carboxy-1-phenylpropylidene)amino]carbamoyl]furan-2-carbonyl]hydrazinylidene]-4-phenylbutanoic acid |
| SMILES | O=C(O)CC/C(=N/NC(=O)c1ccc(C(=O)N/N=C(\CCC(=O)O)c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C26H24N4O7/c31-23(32)15-11-19(17-7-3-1-4-8-17)27-29-25(35)21-13-14-22(37-21)26(36)30-28-20(12-16-24(33)34)18-9-5-2-6-10-18/h1-10,13-14H,11-12,15-16H2,(H,29,35)(H,30,36)(H,31,32)(H,33,34)/b27-19-,28-20+ |
| InChIKey | XLRFHXJOIOJKCG-RIRMOVKSSA-N |
| XLogP | 3.28 |
| TPSA | 170.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|