About 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide
3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 63801009) has the molecular formula C14H16N4O2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide |
| PubChem CID | 63801009 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CCCn1ccc(=O)n(Cc2cccnc2C(N)=S)c1=O |
| InChI | InChI=1S/C14H16N4O2S/c1-2-7-17-8-5-11(19)18(14(17)20)9-10-4-3-6-16-12(10)13(15)21/h3-6,8H,2,7,9H2,1H3,(H2,15,21) |
| InChIKey | MDIRPQSMJVELDI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide?
The IUPAC name of 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide (CID 63801009) is 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide.
What is the SMILES notation for 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide?
The canonical SMILES for 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide is CCCn1ccc(=O)n(Cc2cccnc2C(N)=S)c1=O.
What is the InChIKey of 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide?
The InChIKey is MDIRPQSMJVELDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2S/c1-2-7-17-8-5-11(19)18(14(17)20)9-10-4-3-6-16-12(10)13(15)21/h3-6,8H,2,7,9H2,1H3,(H2,15,21).
What are the key properties of 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide?
3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide has a molecular weight of 304.38 g/mol, XLogP of 0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dioxo-3-propylpyrimidin-1-yl)methyl]pyridine-2-carbothioamide is sourced from PubChem (CID 63801009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).