C13H11N3O5 — CID 63801169
1-[2-(2-methylphenyl)-2-oxoethyl]-5-nitropyrimidine-2,4-dione (PubChem CID 63801169) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 1-[2-(2-methylphenyl)-2-oxoethyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[2-(2-methylphenyl)-2-oxoethyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63801169 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-[2-(2-methylphenyl)-2-oxoethyl]-5-nitropyrimidine-2,4-dione |
| SMILES | Cc1ccccc1C(=O)Cn1cc([N+](=O)[O-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H11N3O5/c1-8-4-2-3-5-9(8)11(17)7-15-6-10(16(20)21)12(18)14-13(15)19/h2-6H,7H2,1H3,(H,14,18,19) |
| InChIKey | CUJZODNVBXKOMO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|