C10H14F3N3O3 — CID 63801334
5-amino-1-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 63801334) has the molecular formula C10H14F3N3O3 and a molecular weight of 281.23 g/mol. Its IUPAC name is 5-amino-1-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63801334 |
| Molecular Formula | C10H14F3N3O3 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-amino-1-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | CCn1cc(N)c(=O)n(CCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H14F3N3O3/c1-2-15-5-7(14)8(17)16(9(15)18)3-4-19-6-10(11,12)13/h5H,2-4,6,14H2,1H3 |
| InChIKey | HLOIBZXZYSEZCQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|