C12H11F2N3O2S — CID 63801722
3,5-difluoro-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde (PubChem CID 63801722) has the molecular formula C12H11F2N3O2S and a molecular weight of 299.30 g/mol. Its IUPAC name is 3,5-difluoro-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde.
| Compound Name | 3,5-difluoro-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 63801722 |
| Molecular Formula | C12H11F2N3O2S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3,5-difluoro-4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde |
| SMILES | CCCn1c(Sc2c(F)cc(C=O)cc2F)n[nH]c1=O |
| InChI | InChI=1S/C12H11F2N3O2S/c1-2-3-17-11(19)15-16-12(17)20-10-8(13)4-7(6-18)5-9(10)14/h4-6H,2-3H2,1H3,(H,15,19) |
| InChIKey | OKJGXBSKHBVXHJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|