C10H7ClN2O2S — CID 63802046
2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzaldehyde (PubChem CID 63802046) has the molecular formula C10H7ClN2O2S and a molecular weight of 254.70 g/mol. Its IUPAC name is 2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzaldehyde.
| Compound Name | 2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 63802046 |
| Molecular Formula | C10H7ClN2O2S |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 2-chloro-6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]benzaldehyde |
| SMILES | Cc1nnc(Sc2cccc(Cl)c2C=O)o1 |
| InChI | InChI=1S/C10H7ClN2O2S/c1-6-12-13-10(15-6)16-9-4-2-3-8(11)7(9)5-14/h2-5H,1H3 |
| InChIKey | AQKFYQBIERJLAC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|