C14H10F2O2S — CID 63802183
3,5-difluoro-4-(3-methoxyphenyl)sulfanylbenzaldehyde (PubChem CID 63802183) has the molecular formula C14H10F2O2S and a molecular weight of 280.30 g/mol. Its IUPAC name is 3,5-difluoro-4-(3-methoxyphenyl)sulfanylbenzaldehyde.
| Compound Name | 3,5-difluoro-4-(3-methoxyphenyl)sulfanylbenzaldehyde |
|---|---|
| PubChem CID | 63802183 |
| Molecular Formula | C14H10F2O2S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 3,5-difluoro-4-(3-methoxyphenyl)sulfanylbenzaldehyde |
| SMILES | COc1cccc(Sc2c(F)cc(C=O)cc2F)c1 |
| InChI | InChI=1S/C14H10F2O2S/c1-18-10-3-2-4-11(7-10)19-14-12(15)5-9(8-17)6-13(14)16/h2-8H,1H3 |
| InChIKey | YXKSCTNMLWBMTP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|