C11H9F2N3O2S — CID 63802234
4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3,5-difluorobenzaldehyde (PubChem CID 63802234) has the molecular formula C11H9F2N3O2S and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3,5-difluorobenzaldehyde.
| Compound Name | 4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 63802234 |
| Molecular Formula | C11H9F2N3O2S |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-3,5-difluorobenzaldehyde |
| SMILES | CCn1c(Sc2c(F)cc(C=O)cc2F)n[nH]c1=O |
| InChI | InChI=1S/C11H9F2N3O2S/c1-2-16-10(18)14-15-11(16)19-9-7(12)3-6(5-17)4-8(9)13/h3-5H,2H2,1H3,(H,14,18) |
| InChIKey | HHOQQQQSVBWDQR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|