C9H5FN2OS2 — CID 63802367
5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde (PubChem CID 63802367) has the molecular formula C9H5FN2OS2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde.
| Compound Name | 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 63802367 |
| Molecular Formula | C9H5FN2OS2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde |
| SMILES | O=Cc1cc(F)ccc1Sc1nncs1 |
| InChI | InChI=1S/C9H5FN2OS2/c10-7-1-2-8(6(3-7)4-13)15-9-12-11-5-14-9/h1-5H |
| InChIKey | FQMONACJHLSIIT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|