About 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde
5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde (PubChem CID 63802367) has the molecular formula C9H5FN2OS2
and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde.
Molecular Properties
| Compound Name | 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde |
| PubChem CID | 63802367 |
| Molecular Formula | C9H5FN2OS2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde |
| SMILES | O=Cc1cc(F)ccc1Sc1nncs1 |
| InChI | InChI=1S/C9H5FN2OS2/c10-7-1-2-8(6(3-7)4-13)15-9-12-11-5-14-9/h1-5H |
| InChIKey | FQMONACJHLSIIT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde?
The IUPAC name of 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde (CID 63802367) is 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde.
What is the SMILES notation for 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde?
The canonical SMILES for 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde is O=Cc1cc(F)ccc1Sc1nncs1.
What is the InChIKey of 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde?
The InChIKey is FQMONACJHLSIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FN2OS2/c10-7-1-2-8(6(3-7)4-13)15-9-12-11-5-14-9/h1-5H.
What are the key properties of 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde?
5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde has a molecular weight of 240.28 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzaldehyde is sourced from PubChem (CID 63802367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).