C14H12BrF2NO — CID 63802444
2-[4-(3-bromophenoxy)-3,5-difluorophenyl]ethanamine (PubChem CID 63802444) has the molecular formula C14H12BrF2NO and a molecular weight of 328.16 g/mol. Its IUPAC name is 2-[4-(3-bromophenoxy)-3,5-difluorophenyl]ethanamine.
| Compound Name | 2-[4-(3-bromophenoxy)-3,5-difluorophenyl]ethanamine |
|---|---|
| PubChem CID | 63802444 |
| Molecular Formula | C14H12BrF2NO |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[4-(3-bromophenoxy)-3,5-difluorophenyl]ethanamine |
| SMILES | NCCc1cc(F)c(Oc2cccc(Br)c2)c(F)c1 |
| InChI | InChI=1S/C14H12BrF2NO/c15-10-2-1-3-11(8-10)19-14-12(16)6-9(4-5-18)7-13(14)17/h1-3,6-8H,4-5,18H2 |
| InChIKey | SWMGUPLBALXHGQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |