C15H14F3NO — CID 63803167
1-[2-(2,5-difluorophenoxy)-5-fluorophenyl]propan-2-amine (PubChem CID 63803167) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenoxy)-5-fluorophenyl]propan-2-amine.
| Compound Name | 1-[2-(2,5-difluorophenoxy)-5-fluorophenyl]propan-2-amine |
|---|---|
| PubChem CID | 63803167 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-[2-(2,5-difluorophenoxy)-5-fluorophenyl]propan-2-amine |
| SMILES | CC(N)Cc1cc(F)ccc1Oc1cc(F)ccc1F |
| InChI | InChI=1S/C15H14F3NO/c1-9(19)6-10-7-11(16)3-5-14(10)20-15-8-12(17)2-4-13(15)18/h2-5,7-9H,6,19H2,1H3 |
| InChIKey | VLWLSPXCKNWOJW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |