About Phenyl(O-tolyl)silane
Phenyl(O-tolyl)silane (PubChem CID 6380345) has the molecular formula C13H12Si
and a molecular weight of 196.32 g/mol.
Molecular Properties
| Compound Name | Phenyl(O-tolyl)silane |
| PubChem CID | 6380345 |
| Molecular Formula | C13H12Si |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[Si]c1ccccc1 |
| InChI | InChI=1S/C13H12Si/c1-11-7-5-6-10-13(11)14-12-8-3-2-4-9-12/h2-10H,1H3 |
| InChIKey | UNWKJQVCHYOIGT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Phenyl(O-tolyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phenyl(O-tolyl)silane?
The IUPAC name of Phenyl(O-tolyl)silane (CID 6380345) is not available.
What is the SMILES notation for Phenyl(O-tolyl)silane?
The canonical SMILES for Phenyl(O-tolyl)silane is Cc1ccccc1[Si]c1ccccc1.
What is the InChIKey of Phenyl(O-tolyl)silane?
The InChIKey is UNWKJQVCHYOIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Si/c1-11-7-5-6-10-13(11)14-12-8-3-2-4-9-12/h2-10H,1H3.
What are the key properties of Phenyl(O-tolyl)silane?
Phenyl(O-tolyl)silane has a molecular weight of 196.32 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Phenyl(O-tolyl)silane is sourced from PubChem (CID 6380345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).