C22H34O5 — CID 638044
7-[(1S,2S)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid (PubChem CID 638044) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is 7-[(1S,2S)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid.
| Compound Name | 7-[(1S,2S)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 638044 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 7-[(1S,2S)-2-[(E,3R)-3-acetyloxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| SMILES | CCCCC[C@H](/C=C/[C@H]1C=CC(=O)[C@H]1CCCCCCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C22H34O5/c1-3-4-7-10-19(27-17(2)23)15-13-18-14-16-21(24)20(18)11-8-5-6-9-12-22(25)26/h13-16,18-20H,3-12H2,1-2H3,(H,25,26)/b15-13+/t18-,19+,20-/m0/s1 |
| InChIKey | JBHCLLWFVBNWQD-TYZLDMMHSA-N |
| XLogP | 4.85 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|