About (3S)-3-methylhexane
(3S)-3-methylhexane (PubChem CID 638046) has the molecular formula C7H16
and a molecular weight of 100.20 g/mol. Its IUPAC name is (3S)-3-methylhexane.
Molecular Properties
| Compound Name | (3S)-3-methylhexane |
| PubChem CID | 638046 |
| Molecular Formula | C7H16 |
| Molecular Weight | 100.20 g/mol |
| Exact Mass | 100.13 |
| IUPAC Name | (3S)-3-methylhexane |
| SMILES | CCC[C@@H](C)CC |
| InChI | InChI=1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | VLJXXKKOSFGPHI-ZETCQYMHSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3S)-3-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methylhexane?
The IUPAC name of (3S)-3-methylhexane (CID 638046) is (3S)-3-methylhexane.
What is the SMILES notation for (3S)-3-methylhexane?
The canonical SMILES for (3S)-3-methylhexane is CCC[C@@H](C)CC.
What is the InChIKey of (3S)-3-methylhexane?
The InChIKey is VLJXXKKOSFGPHI-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3/t7-/m0/s1.
What are the key properties of (3S)-3-methylhexane?
(3S)-3-methylhexane has a molecular weight of 100.20 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methylhexane is sourced from PubChem (CID 638046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).