About N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine
N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine (PubChem CID 63805216) has the molecular formula C15H19F2N3S
and a molecular weight of 311.40 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine |
| PubChem CID | 63805216 |
| Molecular Formula | C15H19F2N3S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cc(F)c(Sc2nccn2C)c(F)c1 |
| InChI | InChI=1S/C15H19F2N3S/c1-10(2)8-18-9-11-6-12(16)14(13(17)7-11)21-15-19-4-5-20(15)3/h4-7,10,18H,8-9H2,1-3H3 |
| InChIKey | FQWMUQSNFXZIKJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine?
The IUPAC name of N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine (CID 63805216) is N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine is CC(C)CNCc1cc(F)c(Sc2nccn2C)c(F)c1.
What is the InChIKey of N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine?
The InChIKey is FQWMUQSNFXZIKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2N3S/c1-10(2)8-18-9-11-6-12(16)14(13(17)7-11)21-15-19-4-5-20(15)3/h4-7,10,18H,8-9H2,1-3H3.
What are the key properties of N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine?
N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine has a molecular weight of 311.40 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,5-difluoro-4-(1-methylimidazol-2-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine is sourced from PubChem (CID 63805216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).