C9H16 — CID 638055
(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 638055) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 638055 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | C1CC[C@@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C9H16/c1-2-5-9-7-3-6-8(9)4-1/h8-9H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | BNRNAKTVFSZAFA-RKDXNWHRSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |