About (2S,4R)-tricyclo[3.2.2.02,4]nonane
(2S,4R)-tricyclo[3.2.2.02,4]nonane (PubChem CID 638059) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is (2S,4R)-tricyclo[3.2.2.02,4]nonane.
Molecular Properties
| Compound Name | (2S,4R)-tricyclo[3.2.2.02,4]nonane |
| PubChem CID | 638059 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (2S,4R)-tricyclo[3.2.2.02,4]nonane |
| SMILES | C1CC2CCC1[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C9H14/c1-2-7-4-3-6(1)8-5-9(7)8/h6-9H,1-5H2/t6?,7?,8-,9+ |
| InChIKey | WNYJJKBPJRYWNZ-WZENYGAOSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2S,4R)-tricyclo[3.2.2.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-tricyclo[3.2.2.02,4]nonane?
The IUPAC name of (2S,4R)-tricyclo[3.2.2.02,4]nonane (CID 638059) is (2S,4R)-tricyclo[3.2.2.02,4]nonane.
What is the SMILES notation for (2S,4R)-tricyclo[3.2.2.02,4]nonane?
The canonical SMILES for (2S,4R)-tricyclo[3.2.2.02,4]nonane is C1CC2CCC1[C@H]1C[C@@H]21.
What is the InChIKey of (2S,4R)-tricyclo[3.2.2.02,4]nonane?
The InChIKey is WNYJJKBPJRYWNZ-WZENYGAOSA-N. The full InChI is InChI=1S/C9H14/c1-2-7-4-3-6(1)8-5-9(7)8/h6-9H,1-5H2/t6?,7?,8-,9+.
What are the key properties of (2S,4R)-tricyclo[3.2.2.02,4]nonane?
(2S,4R)-tricyclo[3.2.2.02,4]nonane has a molecular weight of 122.21 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-tricyclo[3.2.2.02,4]nonane is sourced from PubChem (CID 638059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).