About [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium
[(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium (PubChem CID 6380651) has the molecular formula C23H34N4+2
and a molecular weight of 366.55 g/mol. Its IUPAC name is [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium.
Molecular Properties
| Compound Name | [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium |
| PubChem CID | 6380651 |
| Molecular Formula | C23H34N4+2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium |
| SMILES | C[N+](C)(C)/N=C(\CCC/C(=N\[N+](C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H34N4/c1-26(2,3)24-22(20-14-9-7-10-15-20)18-13-19-23(25-27(4,5)6)21-16-11-8-12-17-21/h7-12,14-17H,13,18-19H2,1-6H3/q+2/b24-22+,25-23+ |
| InChIKey | SXYPCUIYGVGESV-BQASJOSNSA-N |
| XLogP | 4.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium?
The IUPAC name of [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium (CID 6380651) is [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium.
What is the SMILES notation for [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium?
The canonical SMILES for [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium is C[N+](C)(C)/N=C(\CCC/C(=N\[N+](C)(C)C)c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium?
The InChIKey is SXYPCUIYGVGESV-BQASJOSNSA-N. The full InChI is InChI=1S/C23H34N4/c1-26(2,3)24-22(20-14-9-7-10-15-20)18-13-19-23(25-27(4,5)6)21-16-11-8-12-17-21/h7-12,14-17H,13,18-19H2,1-6H3/q+2/b24-22+,25-23+.
What are the key properties of [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium?
[(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium has a molecular weight of 366.55 g/mol, XLogP of 4.38, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[(5E)-1,5-diphenyl-5-(trimethylazaniumyl)iminopentylidene]amino]-trimethylazanium is sourced from PubChem (CID 6380651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).