C13H20FNO2S2 — CID 63806922
N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 63806922) has the molecular formula C13H20FNO2S2 and a molecular weight of 305.44 g/mol. Its IUPAC name is N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63806922 |
| Molecular Formula | C13H20FNO2S2 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[[5-fluoro-2-(2-methylsulfonylethylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)ccc1SCCS(C)(=O)=O |
| InChI | InChI=1S/C13H20FNO2S2/c1-3-6-15-10-11-9-12(14)4-5-13(11)18-7-8-19(2,16)17/h4-5,9,15H,3,6-8,10H2,1-2H3 |
| InChIKey | UOIUBUCAGPHPJV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|