C15H16ClN3S — CID 63807191
N-[[2-chloro-6-(4-methylpyrimidin-2-yl)sulfanylphenyl]methyl]cyclopropanamine (PubChem CID 63807191) has the molecular formula C15H16ClN3S and a molecular weight of 305.83 g/mol. Its IUPAC name is N-[[2-chloro-6-(4-methylpyrimidin-2-yl)sulfanylphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-chloro-6-(4-methylpyrimidin-2-yl)sulfanylphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63807191 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[[2-chloro-6-(4-methylpyrimidin-2-yl)sulfanylphenyl]methyl]cyclopropanamine |
| SMILES | Cc1ccnc(Sc2cccc(Cl)c2CNC2CC2)n1 |
| InChI | InChI=1S/C15H16ClN3S/c1-10-7-8-17-15(19-10)20-14-4-2-3-13(16)12(14)9-18-11-5-6-11/h2-4,7-8,11,18H,5-6,9H2,1H3 |
| InChIKey | BRTJWXCWBIZYCO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |