C14H17N3O2S — CID 63807968
2-[2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 63807968) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 63807968 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[2-[(2-methoxyethylamino)methyl]phenyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | COCCNCc1ccccc1Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C14H17N3O2S/c1-19-9-8-15-10-11-4-2-3-5-12(11)20-14-16-7-6-13(18)17-14/h2-7,15H,8-10H2,1H3,(H,16,17,18) |
| InChIKey | LZYBNEFWLYEVDN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|