C14H14ClNS — CID 63808082
1-[2-(3-chlorophenyl)sulfanylphenyl]-N-methylmethanamine (PubChem CID 63808082) has the molecular formula C14H14ClNS and a molecular weight of 263.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)sulfanylphenyl]-N-methylmethanamine.
| Compound Name | 1-[2-(3-chlorophenyl)sulfanylphenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63808082 |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-[2-(3-chlorophenyl)sulfanylphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccccc1Sc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H14ClNS/c1-16-10-11-5-2-3-8-14(11)17-13-7-4-6-12(15)9-13/h2-9,16H,10H2,1H3 |
| InChIKey | OZZOWDGNDAFHOS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |