About ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate
ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate (PubChem CID 63809270) has the molecular formula C14H21N3O2S2
and a molecular weight of 327.48 g/mol. Its IUPAC name is ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate |
| PubChem CID | 63809270 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc2sccn2c1CNC(C)(C)C |
| InChI | InChI=1S/C14H21N3O2S2/c1-5-19-11(18)9-21-12-10(8-15-14(2,3)4)17-6-7-20-13(17)16-12/h6-7,15H,5,8-9H2,1-4H3 |
| InChIKey | XHYPJSZUGHXBKU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate?
The IUPAC name of ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate (CID 63809270) is ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate.
What is the SMILES notation for ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate?
The canonical SMILES for ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate is CCOC(=O)CSc1nc2sccn2c1CNC(C)(C)C.
What is the InChIKey of ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate?
The InChIKey is XHYPJSZUGHXBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2S2/c1-5-19-11(18)9-21-12-10(8-15-14(2,3)4)17-6-7-20-13(17)16-12/h6-7,15H,5,8-9H2,1-4H3.
What are the key properties of ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate?
ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate has a molecular weight of 327.48 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-[(tert-butylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylacetate is sourced from PubChem (CID 63809270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).