C9H11F3N2O2 — CID 63810453
1-propyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione (PubChem CID 63810453) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-propyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione.
| Compound Name | 1-propyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63810453 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-propyl-3-(2,2,2-trifluoroethyl)pyrimidine-2,4-dione |
| SMILES | CCCn1ccc(=O)n(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H11F3N2O2/c1-2-4-13-5-3-7(15)14(8(13)16)6-9(10,11)12/h3,5H,2,4,6H2,1H3 |
| InChIKey | UWLJBBIMQVZJDT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |