About 1-(oxolan-3-yl)imidazole
1-(oxolan-3-yl)imidazole (PubChem CID 63810500) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(oxolan-3-yl)imidazole.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)imidazole |
| PubChem CID | 63810500 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 1-(oxolan-3-yl)imidazole |
| SMILES | c1cn(C2CCOC2)cn1 |
| InChI | InChI=1S/C7H10N2O/c1-4-10-5-7(1)9-3-2-8-6-9/h2-3,6-7H,1,4-5H2 |
| InChIKey | FXLDYFJKUDSHIO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(oxolan-3-yl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)imidazole?
The IUPAC name of 1-(oxolan-3-yl)imidazole (CID 63810500) is 1-(oxolan-3-yl)imidazole.
What is the SMILES notation for 1-(oxolan-3-yl)imidazole?
The canonical SMILES for 1-(oxolan-3-yl)imidazole is c1cn(C2CCOC2)cn1.
What is the InChIKey of 1-(oxolan-3-yl)imidazole?
The InChIKey is FXLDYFJKUDSHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-4-10-5-7(1)9-3-2-8-6-9/h2-3,6-7H,1,4-5H2.
What are the key properties of 1-(oxolan-3-yl)imidazole?
1-(oxolan-3-yl)imidazole has a molecular weight of 138.17 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)imidazole is sourced from PubChem (CID 63810500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).