C11H15F3N2O3 — CID 63810597
1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione (PubChem CID 63810597) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63810597 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(CCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H15F3N2O3/c1-2-15-6-4-9(17)16(10(15)18)5-3-7-19-8-11(12,13)14/h4,6H,2-3,5,7-8H2,1H3 |
| InChIKey | KVWYFAUNBONFTI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|