C8H9F3N2O3 — CID 63810752
1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 63810752) has the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63810752 |
| Molecular Formula | C8H9F3N2O3 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCOCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H9F3N2O3/c9-8(10,11)5-16-4-3-13-2-1-6(14)12-7(13)15/h1-2H,3-5H2,(H,12,14,15) |
| InChIKey | SXVGSCTUFUXFBQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|