5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid

C12H14N2O3 — CID 63810885

IUPAC5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid
SMILESCCn1nc(C)c(-c2ccc(C(=O)O)o2)c1C
InChIInChI=1S/C12H14N2O3/c1-4-14-8(3)11(7(2)13-14)9-5-6-10(17-9)12(15)16/h5-6H,4H2,1-3H3,(H,15,16)
InChIKeyQXJHEQJYNFFWFU-UHFFFAOYSA-N
MW234.25 g/mol
LogP2.48
Rot. Bonds3

About 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid

5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid (PubChem CID 63810885) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid.

Molecular Properties

Compound Name5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid
PubChem CID63810885
Molecular FormulaC12H14N2O3
Molecular Weight234.25 g/mol
Exact Mass234.10
IUPAC Name5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid
SMILESCCn1nc(C)c(-c2ccc(C(=O)O)o2)c1C
InChIInChI=1S/C12H14N2O3/c1-4-14-8(3)11(7(2)13-14)9-5-6-10(17-9)12(15)16/h5-6H,4H2,1-3H3,(H,15,16)
InChIKeyQXJHEQJYNFFWFU-UHFFFAOYSA-N
XLogP2.48
TPSA68.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.25
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid?
The IUPAC name of 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid (CID 63810885) is 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid.
What is the SMILES notation for 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid?
The canonical SMILES for 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid is CCn1nc(C)c(-c2ccc(C(=O)O)o2)c1C.
What is the InChIKey of 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid?
The InChIKey is QXJHEQJYNFFWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-4-14-8(3)11(7(2)13-14)9-5-6-10(17-9)12(15)16/h5-6H,4H2,1-3H3,(H,15,16).
What are the key properties of 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid?
5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid has a molecular weight of 234.25 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)furan-2-carboxylic acid is sourced from PubChem (CID 63810885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).