About 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one
5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 63810945) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 63810945 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(Cn2cccn2)O1 |
| InChI | InChI=1S/C7H9N3O2/c11-7-8-4-6(12-7)5-10-3-1-2-9-10/h1-3,6H,4-5H2,(H,8,11) |
| InChIKey | QUEKWXVFPYMJIT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one (CID 63810945) is 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one is O=C1NCC(Cn2cccn2)O1.
What is the InChIKey of 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one?
The InChIKey is QUEKWXVFPYMJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c11-7-8-4-6(12-7)5-10-3-1-2-9-10/h1-3,6H,4-5H2,(H,8,11).
What are the key properties of 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one?
5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one has a molecular weight of 167.17 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(pyrazol-1-ylmethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 63810945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).