About 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide
3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide (PubChem CID 63811315) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide |
| PubChem CID | 63811315 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2cncn2)C1 |
| InChI | InChI=1S/C6H9N3O2S/c10-12(11)2-1-6(3-12)9-5-7-4-8-9/h4-6H,1-3H2 |
| InChIKey | CTCKNDPADRYWGH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
The IUPAC name of 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide (CID 63811315) is 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide.
What is the SMILES notation for 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
The canonical SMILES for 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide is O=S1(=O)CCC(n2cncn2)C1.
What is the InChIKey of 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
The InChIKey is CTCKNDPADRYWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c10-12(11)2-1-6(3-12)9-5-7-4-8-9/h4-6H,1-3H2.
What are the key properties of 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide has a molecular weight of 187.22 g/mol, XLogP of -0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-1-yl)thiolane 1,1-dioxide is sourced from PubChem (CID 63811315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).