About 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one
1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one (PubChem CID 63811320) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one |
| PubChem CID | 63811320 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one |
| SMILES | Cc1cc(C)n(-c2nccn(C3CC3)c2=O)n1 |
| InChI | InChI=1S/C12H14N4O/c1-8-7-9(2)16(14-8)11-12(17)15(6-5-13-11)10-3-4-10/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | AVOPKFMHNJCSJP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one?
The IUPAC name of 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one (CID 63811320) is 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one.
What is the SMILES notation for 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one?
The canonical SMILES for 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one is Cc1cc(C)n(-c2nccn(C3CC3)c2=O)n1.
What is the InChIKey of 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one?
The InChIKey is AVOPKFMHNJCSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-8-7-9(2)16(14-8)11-12(17)15(6-5-13-11)10-3-4-10/h5-7,10H,3-4H2,1-2H3.
What are the key properties of 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one?
1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one has a molecular weight of 230.27 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(3,5-dimethylpyrazol-1-yl)pyrazin-2-one is sourced from PubChem (CID 63811320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).