C7H6N4O3 — CID 63811371
1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidine-2,4-dione (PubChem CID 63811371) has the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. Its IUPAC name is 1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63811371 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(Cc2ncon2)c(=O)[nH]1 |
| InChI | InChI=1S/C7H6N4O3/c12-6-1-2-11(7(13)9-6)3-5-8-4-14-10-5/h1-2,4H,3H2,(H,9,12,13) |
| InChIKey | UMCUOKAPCZBYSV-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |