About 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione
1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 63811440) has the molecular formula C9H8N4O4S
and a molecular weight of 268.25 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione |
| PubChem CID | 63811440 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | Cc1ncc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)s1 |
| InChI | InChI=1S/C9H8N4O4S/c1-5-10-2-6(18-5)3-12-4-7(13(16)17)8(14)11-9(12)15/h2,4H,3H2,1H3,(H,11,14,15) |
| InChIKey | ZHUOVGRJARPVIB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione?
The IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione (CID 63811440) is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione.
What is the SMILES notation for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione?
The canonical SMILES for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione is Cc1ncc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)s1.
What is the InChIKey of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione?
The InChIKey is ZHUOVGRJARPVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O4S/c1-5-10-2-6(18-5)3-12-4-7(13(16)17)8(14)11-9(12)15/h2,4H,3H2,1H3,(H,11,14,15).
What are the key properties of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione?
1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione has a molecular weight of 268.25 g/mol, XLogP of 0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-5-nitropyrimidine-2,4-dione is sourced from PubChem (CID 63811440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).