About 1-hexylpyrimidine-2,4-dione
1-hexylpyrimidine-2,4-dione (PubChem CID 63811865) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-hexylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-hexylpyrimidine-2,4-dione |
| PubChem CID | 63811865 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-hexylpyrimidine-2,4-dione |
| SMILES | CCCCCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N2O2/c1-2-3-4-5-7-12-8-6-9(13)11-10(12)14/h6,8H,2-5,7H2,1H3,(H,11,13,14) |
| InChIKey | KTAGXUPEDBBOFG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylpyrimidine-2,4-dione?
The IUPAC name of 1-hexylpyrimidine-2,4-dione (CID 63811865) is 1-hexylpyrimidine-2,4-dione.
What is the SMILES notation for 1-hexylpyrimidine-2,4-dione?
The canonical SMILES for 1-hexylpyrimidine-2,4-dione is CCCCCCn1ccc(=O)[nH]c1=O.
What is the InChIKey of 1-hexylpyrimidine-2,4-dione?
The InChIKey is KTAGXUPEDBBOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-2-3-4-5-7-12-8-6-9(13)11-10(12)14/h6,8H,2-5,7H2,1H3,(H,11,13,14).
What are the key properties of 1-hexylpyrimidine-2,4-dione?
1-hexylpyrimidine-2,4-dione has a molecular weight of 196.25 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylpyrimidine-2,4-dione is sourced from PubChem (CID 63811865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).