About 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole
4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole (PubChem CID 63812336) has the molecular formula C9H5N5O2S
and a molecular weight of 247.24 g/mol. Its IUPAC name is 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole |
| PubChem CID | 63812336 |
| Molecular Formula | C9H5N5O2S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1c(-n2cncn2)ccc2scnc12 |
| InChI | InChI=1S/C9H5N5O2S/c15-14(16)9-6(13-4-10-3-12-13)1-2-7-8(9)11-5-17-7/h1-5H |
| InChIKey | XVTHEROPXISTAN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole?
The IUPAC name of 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole (CID 63812336) is 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole.
What is the SMILES notation for 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole?
The canonical SMILES for 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole is O=[N+]([O-])c1c(-n2cncn2)ccc2scnc12.
What is the InChIKey of 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole?
The InChIKey is XVTHEROPXISTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N5O2S/c15-14(16)9-6(13-4-10-3-12-13)1-2-7-8(9)11-5-17-7/h1-5H.
What are the key properties of 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole?
4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole has a molecular weight of 247.24 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-5-(1,2,4-triazol-1-yl)-1,3-benzothiazole is sourced from PubChem (CID 63812336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).